C10H16NO2- — CID 19431537
2-amino-2,2-di(cyclobutyl)acetate (PubChem CID 19431537) has the molecular formula C10H16NO2- and a molecular weight of 182.24 g/mol. Its IUPAC name is 2-amino-2,2-di(cyclobutyl)acetate.
| Compound Name | 2-amino-2,2-di(cyclobutyl)acetate |
|---|---|
| PubChem CID | 19431537 |
| Molecular Formula | C10H16NO2- |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-amino-2,2-di(cyclobutyl)acetate |
| SMILES | NC(C(=O)[O-])(C1CCC1)C1CCC1 |
| InChI | InChI=1S/C10H17NO2/c11-10(9(12)13,7-3-1-4-7)8-5-2-6-8/h7-8H,1-6,11H2,(H,12,13)/p-1 |
| InChIKey | VDWQTNOPQRIQNR-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |