C16H18N2O2S — CID 19431751
4-[2-amino-6-(3-aminophenyl)sulfanylphenyl]butanoic acid (PubChem CID 19431751) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 4-[2-amino-6-(3-aminophenyl)sulfanylphenyl]butanoic acid.
| Compound Name | 4-[2-amino-6-(3-aminophenyl)sulfanylphenyl]butanoic acid |
|---|---|
| PubChem CID | 19431751 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 4-[2-amino-6-(3-aminophenyl)sulfanylphenyl]butanoic acid |
| SMILES | Nc1cccc(Sc2cccc(N)c2CCCC(=O)O)c1 |
| InChI | InChI=1S/C16H18N2O2S/c17-11-4-1-5-12(10-11)21-15-8-3-7-14(18)13(15)6-2-9-16(19)20/h1,3-5,7-8,10H,2,6,9,17-18H2,(H,19,20) |
| InChIKey | NDPBFMKMURSCFS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|