C23H25F3N2O2 — CID 19434842
2-(4-amino-3-fluorophenyl)-6,8-difluoro-5-(heptylamino)-7-methylchromen-4-one (PubChem CID 19434842) has the molecular formula C23H25F3N2O2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 2-(4-amino-3-fluorophenyl)-6,8-difluoro-5-(heptylamino)-7-methylchromen-4-one.
| Compound Name | 2-(4-amino-3-fluorophenyl)-6,8-difluoro-5-(heptylamino)-7-methylchromen-4-one |
|---|---|
| PubChem CID | 19434842 |
| Molecular Formula | C23H25F3N2O2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-(4-amino-3-fluorophenyl)-6,8-difluoro-5-(heptylamino)-7-methylchromen-4-one |
| SMILES | CCCCCCCNc1c(F)c(C)c(F)c2oc(-c3ccc(N)c(F)c3)cc(=O)c12 |
| InChI | InChI=1S/C23H25F3N2O2/c1-3-4-5-6-7-10-28-22-19-17(29)12-18(14-8-9-16(27)15(24)11-14)30-23(19)21(26)13(2)20(22)25/h8-9,11-12,28H,3-7,10,27H2,1-2H3 |
| InChIKey | YTHQTEWNZKOSKP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|