C27H33FN2O3 — CID 150350051
N-[2-fluoro-4-[5-(hexylamino)-7-methyl-4-oxochromen-2-yl]phenyl]-2,2-dimethylpropanamide (PubChem CID 150350051) has the molecular formula C27H33FN2O3 and a molecular weight of 452.57 g/mol. Its IUPAC name is N-[2-fluoro-4-[5-(hexylamino)-7-methyl-4-oxochromen-2-yl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-fluoro-4-[5-(hexylamino)-7-methyl-4-oxochromen-2-yl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 150350051 |
| Molecular Formula | C27H33FN2O3 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | N-[2-fluoro-4-[5-(hexylamino)-7-methyl-4-oxochromen-2-yl]phenyl]-2,2-dimethylpropanamide |
| SMILES | CCCCCCNc1cc(C)cc2oc(-c3ccc(NC(=O)C(C)(C)C)c(F)c3)cc(=O)c12 |
| InChI | InChI=1S/C27H33FN2O3/c1-6-7-8-9-12-29-21-13-17(2)14-24-25(21)22(31)16-23(33-24)18-10-11-20(19(28)15-18)30-26(32)27(3,4)5/h10-11,13-16,29H,6-9,12H2,1-5H3,(H,30,32) |
| InChIKey | GTNXOONRJBHKQI-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|