C27H32F3N3O3 — CID 19434841
N-[4-[5-[3-(diethylamino)propylamino]-6,8-difluoro-4-oxochromen-2-yl]-2-fluorophenyl]-2,2-dimethylpropanamide (PubChem CID 19434841) has the molecular formula C27H32F3N3O3 and a molecular weight of 503.57 g/mol. Its IUPAC name is N-[4-[5-[3-(diethylamino)propylamino]-6,8-difluoro-4-oxochromen-2-yl]-2-fluorophenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[5-[3-(diethylamino)propylamino]-6,8-difluoro-4-oxochromen-2-yl]-2-fluorophenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 19434841 |
| Molecular Formula | C27H32F3N3O3 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | N-[4-[5-[3-(diethylamino)propylamino]-6,8-difluoro-4-oxochromen-2-yl]-2-fluorophenyl]-2,2-dimethylpropanamide |
| SMILES | CCN(CC)CCCNc1c(F)cc(F)c2oc(-c3ccc(NC(=O)C(C)(C)C)c(F)c3)cc(=O)c12 |
| InChI | InChI=1S/C27H32F3N3O3/c1-6-33(7-2)12-8-11-31-24-18(29)14-19(30)25-23(24)21(34)15-22(36-25)16-9-10-20(17(28)13-16)32-26(35)27(3,4)5/h9-10,13-15,31H,6-8,11-12H2,1-5H3,(H,32,35) |
| InChIKey | YHBGHFPASNEWAN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|