C24H24ClF3N2O3 — CID 19434948
N-[4-[5-(4-chlorobutylamino)-6,8-difluoro-4-oxochromen-2-yl]-2-fluorophenyl]-2,2-dimethylpropanamide (PubChem CID 19434948) has the molecular formula C24H24ClF3N2O3 and a molecular weight of 480.91 g/mol. Its IUPAC name is N-[4-[5-(4-chlorobutylamino)-6,8-difluoro-4-oxochromen-2-yl]-2-fluorophenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[5-(4-chlorobutylamino)-6,8-difluoro-4-oxochromen-2-yl]-2-fluorophenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 19434948 |
| Molecular Formula | C24H24ClF3N2O3 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | N-[4-[5-(4-chlorobutylamino)-6,8-difluoro-4-oxochromen-2-yl]-2-fluorophenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(-c2cc(=O)c3c(NCCCCCl)c(F)cc(F)c3o2)cc1F |
| InChI | InChI=1S/C24H24ClF3N2O3/c1-24(2,3)23(32)30-17-7-6-13(10-14(17)26)19-12-18(31)20-21(29-9-5-4-8-25)15(27)11-16(28)22(20)33-19/h6-7,10-12,29H,4-5,8-9H2,1-3H3,(H,30,32) |
| InChIKey | JYRYGTATTHPQIF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|