C20H17F3N2O3 — CID 19438935
3-[2-methoxy-5-(trifluoromethyl)anilino]-4-(1-phenylethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 19438935) has the molecular formula C20H17F3N2O3 and a molecular weight of 390.36 g/mol. Its IUPAC name is 3-[2-methoxy-5-(trifluoromethyl)anilino]-4-(1-phenylethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[2-methoxy-5-(trifluoromethyl)anilino]-4-(1-phenylethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 19438935 |
| Molecular Formula | C20H17F3N2O3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-[2-methoxy-5-(trifluoromethyl)anilino]-4-(1-phenylethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | COc1ccc(C(F)(F)F)cc1Nc1c(NC(C)c2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C20H17F3N2O3/c1-11(12-6-4-3-5-7-12)24-16-17(19(27)18(16)26)25-14-10-13(20(21,22)23)8-9-15(14)28-2/h3-11,24-25H,1-2H3 |
| InChIKey | YXIZUCXKIWLSTM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|