C18H23N5O4 — CID 19442690
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide (PubChem CID 19442690) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 19442690 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-methyl-4-[(3-nitropyrazol-1-yl)methyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1onc(C(=O)NC(C)C2CC3CCC2C3)c1Cn1ccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C18H23N5O4/c1-10(14-8-12-3-4-13(14)7-12)19-18(24)17-15(11(2)27-21-17)9-22-6-5-16(20-22)23(25)26/h5-6,10,12-14H,3-4,7-9H2,1-2H3,(H,19,24) |
| InChIKey | UQUCRDUIECSUPX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|