C16H14Cl2N6O3 — CID 19476478
N-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-1-ethyl-4-nitropyrazole-5-carboxamide (PubChem CID 19476478) has the molecular formula C16H14Cl2N6O3 and a molecular weight of 409.23 g/mol. Its IUPAC name is N-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-1-ethyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-1-ethyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19476478 |
| Molecular Formula | C16H14Cl2N6O3 |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | N-[4-chloro-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-1-ethyl-4-nitropyrazole-5-carboxamide |
| SMILES | CCn1ncc([N+](=O)[O-])c1C(=O)Nc1nn(Cc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C16H14Cl2N6O3/c1-2-23-14(13(7-19-23)24(26)27)16(25)20-15-12(18)9-22(21-15)8-10-3-5-11(17)6-4-10/h3-7,9H,2,8H2,1H3,(H,20,21,25) |
| InChIKey | VTSLMZHEXHDXGT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|