C16H18ClN3O3 — CID 19506994
2-[(2-chlorophenoxy)methyl]-N-(oxolan-2-ylmethyl)pyrazole-3-carboxamide (PubChem CID 19506994) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 2-[(2-chlorophenoxy)methyl]-N-(oxolan-2-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 2-[(2-chlorophenoxy)methyl]-N-(oxolan-2-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19506994 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-[(2-chlorophenoxy)methyl]-N-(oxolan-2-ylmethyl)pyrazole-3-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1ccnn1COc1ccccc1Cl |
| InChI | InChI=1S/C16H18ClN3O3/c17-13-5-1-2-6-15(13)23-11-20-14(7-8-19-20)16(21)18-10-12-4-3-9-22-12/h1-2,5-8,12H,3-4,9-11H2,(H,18,21) |
| InChIKey | RWMUFEPZOVKAOB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |