C19H22ClN5O2 — CID 19507154
2-[(2-chlorophenoxy)methyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyrazole-3-carboxamide (PubChem CID 19507154) has the molecular formula C19H22ClN5O2 and a molecular weight of 387.87 g/mol. Its IUPAC name is 2-[(2-chlorophenoxy)methyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyrazole-3-carboxamide.
| Compound Name | 2-[(2-chlorophenoxy)methyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19507154 |
| Molecular Formula | C19H22ClN5O2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-[(2-chlorophenoxy)methyl]-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)c2ccnn2COc2ccccc2Cl)n1 |
| InChI | InChI=1S/C19H22ClN5O2/c1-14-12-15(2)24(23-14)11-5-9-21-19(26)17-8-10-22-25(17)13-27-18-7-4-3-6-16(18)20/h3-4,6-8,10,12H,5,9,11,13H2,1-2H3,(H,21,26) |
| InChIKey | CHHBUPUXDXMPJS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|