C10H9F3N6O4 — CID 19511174
3-methoxy-N-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 19511174) has the molecular formula C10H9F3N6O4 and a molecular weight of 334.21 g/mol. Its IUPAC name is 3-methoxy-N-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | 3-methoxy-N-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19511174 |
| Molecular Formula | C10H9F3N6O4 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 3-methoxy-N-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | COc1n[nH]c(C(=O)Nc2c(C(F)(F)F)n[nH]c2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9F3N6O4/c1-3-4(7(17-15-3)10(11,12)13)14-8(20)5-6(19(21)22)9(23-2)18-16-5/h1-2H3,(H,14,20)(H,15,17)(H,16,18) |
| InChIKey | YJMSZSBMGXQCIK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|