C15H15F3N8O3 — CID 19265061
1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]pyrazole-3-carboxamide (PubChem CID 19265061) has the molecular formula C15H15F3N8O3 and a molecular weight of 412.33 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]pyrazole-3-carboxamide.
| Compound Name | 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19265061 |
| Molecular Formula | C15H15F3N8O3 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]pyrazole-3-carboxamide |
| SMILES | Cc1nn(Cn2ccc(C(=O)Nc3c(C(F)(F)F)n[nH]c3C)n2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15F3N8O3/c1-7-11(13(21-20-7)15(16,17)18)19-14(27)10-4-5-24(23-10)6-25-9(3)12(26(28)29)8(2)22-25/h4-5H,6H2,1-3H3,(H,19,27)(H,20,21) |
| InChIKey | SSRDEAIMRVMSFE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|