C17H11IN2O3S — CID 19542166
2-[5-[(4-iodophenoxy)methyl]furan-2-yl]-5-thiophen-2-yl-1,3,4-oxadiazole (PubChem CID 19542166) has the molecular formula C17H11IN2O3S and a molecular weight of 450.26 g/mol. Its IUPAC name is 2-[5-[(4-iodophenoxy)methyl]furan-2-yl]-5-thiophen-2-yl-1,3,4-oxadiazole.
| Compound Name | 2-[5-[(4-iodophenoxy)methyl]furan-2-yl]-5-thiophen-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 19542166 |
| Molecular Formula | C17H11IN2O3S |
| Molecular Weight | 450.26 g/mol |
| Exact Mass | 449.95 |
| IUPAC Name | 2-[5-[(4-iodophenoxy)methyl]furan-2-yl]-5-thiophen-2-yl-1,3,4-oxadiazole |
| SMILES | Ic1ccc(OCc2ccc(-c3nnc(-c4cccs4)o3)o2)cc1 |
| InChI | InChI=1S/C17H11IN2O3S/c18-11-3-5-12(6-4-11)21-10-13-7-8-14(22-13)16-19-20-17(23-16)15-2-1-9-24-15/h1-9H,10H2 |
| InChIKey | HSXCRIMFEWKURY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.26 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|