C16H21BrN4O2S — CID 19573041
1-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3-(2,4-dimethoxyphenyl)thiourea (PubChem CID 19573041) has the molecular formula C16H21BrN4O2S and a molecular weight of 413.34 g/mol. Its IUPAC name is 1-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3-(2,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3-(2,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19573041 |
| Molecular Formula | C16H21BrN4O2S |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 1-[3-(4-bromo-3-methylpyrazol-1-yl)propyl]-3-(2,4-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NCCCn2cc(Br)c(C)n2)c(OC)c1 |
| InChI | InChI=1S/C16H21BrN4O2S/c1-11-13(17)10-21(20-11)8-4-7-18-16(24)19-14-6-5-12(22-2)9-15(14)23-3/h5-6,9-10H,4,7-8H2,1-3H3,(H2,18,19,24) |
| InChIKey | XRQIYZHMDRFAPF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|