C24H22N4O3S — CID 19573407
15-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]-9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaene (PubChem CID 19573407) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 15-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]-9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaene.
| Compound Name | 15-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]-9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaene |
|---|---|
| PubChem CID | 19573407 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 15-[5-[(2-methoxyphenoxy)methyl]furan-2-yl]-9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,14,16-pentaene |
| SMILES | COc1ccccc1OCc1ccc(-c2nc3c4c5c(sc4ncn3n2)CCCCC5)o1 |
| InChI | InChI=1S/C24H22N4O3S/c1-29-17-8-5-6-9-18(17)30-13-15-11-12-19(31-15)22-26-23-21-16-7-3-2-4-10-20(16)32-24(21)25-14-28(23)27-22/h5-6,8-9,11-12,14H,2-4,7,10,13H2,1H3 |
| InChIKey | URCTVIQJDQMTRH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 74.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |