C24H24N4O2S — CID 19583870
12-ethyl-11-methyl-4-[5-[(4-propylphenoxy)methyl]furan-2-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19583870) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 12-ethyl-11-methyl-4-[5-[(4-propylphenoxy)methyl]furan-2-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 12-ethyl-11-methyl-4-[5-[(4-propylphenoxy)methyl]furan-2-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19583870 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 12-ethyl-11-methyl-4-[5-[(4-propylphenoxy)methyl]furan-2-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CCCc1ccc(OCc2ccc(-c3nc4c5c(CC)c(C)sc5ncn4n3)o2)cc1 |
| InChI | InChI=1S/C24H24N4O2S/c1-4-6-16-7-9-17(10-8-16)29-13-18-11-12-20(30-18)22-26-23-21-19(5-2)15(3)31-24(21)25-14-28(23)27-22/h7-12,14H,4-6,13H2,1-3H3 |
| InChIKey | KHXGDIHTGQPEPZ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |