C20H17BrN6S — CID 17023735
4-[4-[(4-bromopyrazol-1-yl)methyl]phenyl]-12-ethyl-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 17023735) has the molecular formula C20H17BrN6S and a molecular weight of 453.37 g/mol. Its IUPAC name is 4-[4-[(4-bromopyrazol-1-yl)methyl]phenyl]-12-ethyl-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[4-[(4-bromopyrazol-1-yl)methyl]phenyl]-12-ethyl-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 17023735 |
| Molecular Formula | C20H17BrN6S |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 4-[4-[(4-bromopyrazol-1-yl)methyl]phenyl]-12-ethyl-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CCc1c(C)sc2ncn3nc(-c4ccc(Cn5cc(Br)cn5)cc4)nc3c12 |
| InChI | InChI=1S/C20H17BrN6S/c1-3-16-12(2)28-20-17(16)19-24-18(25-27(19)11-22-20)14-6-4-13(5-7-14)9-26-10-15(21)8-23-26/h4-8,10-11H,3,9H2,1-2H3 |
| InChIKey | MSYWGYAUJFGKQJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |