C17H11ClN6S — CID 19573610
4-[4-[(4-chloropyrazol-1-yl)methyl]phenyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19573610) has the molecular formula C17H11ClN6S and a molecular weight of 366.84 g/mol. Its IUPAC name is 4-[4-[(4-chloropyrazol-1-yl)methyl]phenyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[4-[(4-chloropyrazol-1-yl)methyl]phenyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19573610 |
| Molecular Formula | C17H11ClN6S |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 4-[4-[(4-chloropyrazol-1-yl)methyl]phenyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Clc1cnn(Cc2ccc(-c3nc4c5ccsc5ncn4n3)cc2)c1 |
| InChI | InChI=1S/C17H11ClN6S/c18-13-7-20-23(9-13)8-11-1-3-12(4-2-11)15-21-16-14-5-6-25-17(14)19-10-24(16)22-15/h1-7,9-10H,8H2 |
| InChIKey | YGXNLMIFQCGXAM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |