C20H13ClN4OS — CID 19573800
4-[3-[(3-chlorophenoxy)methyl]phenyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19573800) has the molecular formula C20H13ClN4OS and a molecular weight of 392.87 g/mol. Its IUPAC name is 4-[3-[(3-chlorophenoxy)methyl]phenyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[3-[(3-chlorophenoxy)methyl]phenyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19573800 |
| Molecular Formula | C20H13ClN4OS |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 4-[3-[(3-chlorophenoxy)methyl]phenyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Clc1cccc(OCc2cccc(-c3nc4c5ccsc5ncn4n3)c2)c1 |
| InChI | InChI=1S/C20H13ClN4OS/c21-15-5-2-6-16(10-15)26-11-13-3-1-4-14(9-13)18-23-19-17-7-8-27-20(17)22-12-25(19)24-18/h1-10,12H,11H2 |
| InChIKey | XWFQDUKWCNMHBS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |