C20H14Cl2N6O — CID 19582593
4-[3-[(2,3-dichlorophenoxy)methyl]phenyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19582593) has the molecular formula C20H14Cl2N6O and a molecular weight of 425.28 g/mol. Its IUPAC name is 4-[3-[(2,3-dichlorophenoxy)methyl]phenyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[3-[(2,3-dichlorophenoxy)methyl]phenyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19582593 |
| Molecular Formula | C20H14Cl2N6O |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 4-[3-[(2,3-dichlorophenoxy)methyl]phenyl]-10-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cn1ncc2c1ncn1nc(-c3cccc(COc4cccc(Cl)c4Cl)c3)nc21 |
| InChI | InChI=1S/C20H14Cl2N6O/c1-27-19-14(9-24-27)20-25-18(26-28(20)11-23-19)13-5-2-4-12(8-13)10-29-16-7-3-6-15(21)17(16)22/h2-9,11H,10H2,1H3 |
| InChIKey | CGDWOWRKIBDYBZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |