C11H9N7S — CID 19573606
1-methyl-5-(10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)pyrazol-4-amine (PubChem CID 19573606) has the molecular formula C11H9N7S and a molecular weight of 271.31 g/mol. Its IUPAC name is 1-methyl-5-(10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)pyrazol-4-amine.
| Compound Name | 1-methyl-5-(10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)pyrazol-4-amine |
|---|---|
| PubChem CID | 19573606 |
| Molecular Formula | C11H9N7S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-methyl-5-(10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)pyrazol-4-amine |
| SMILES | Cn1ncc(N)c1-c1nc2c3ccsc3ncn2n1 |
| InChI | InChI=1S/C11H9N7S/c1-17-8(7(12)4-14-17)9-15-10-6-2-3-19-11(6)13-5-18(10)16-9/h2-5H,12H2,1H3 |
| InChIKey | MFGHAFPXEVFDHP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |