C12H9ClN6S — CID 19573645
4-(4-chloro-1,5-dimethylpyrazol-3-yl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19573645) has the molecular formula C12H9ClN6S and a molecular weight of 304.77 g/mol. Its IUPAC name is 4-(4-chloro-1,5-dimethylpyrazol-3-yl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-(4-chloro-1,5-dimethylpyrazol-3-yl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19573645 |
| Molecular Formula | C12H9ClN6S |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 4-(4-chloro-1,5-dimethylpyrazol-3-yl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1c(Cl)c(-c2nc3c4ccsc4ncn3n2)nn1C |
| InChI | InChI=1S/C12H9ClN6S/c1-6-8(13)9(16-18(6)2)10-15-11-7-3-4-20-12(7)14-5-19(11)17-10/h3-5H,1-2H3 |
| InChIKey | GSJKYSYUIXZUNP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |