C15H15N7O2S — CID 19573775
4-[1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19573775) has the molecular formula C15H15N7O2S and a molecular weight of 357.40 g/mol. Its IUPAC name is 4-[1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19573775 |
| Molecular Formula | C15H15N7O2S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-[1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1nn(CC(C)c2nc3c4ccsc4ncn3n2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N7O2S/c1-8(6-20-10(3)12(22(23)24)9(2)18-20)13-17-14-11-4-5-25-15(11)16-7-21(14)19-13/h4-5,7-8H,6H2,1-3H3 |
| InChIKey | LAAHCJXMZNGCJZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 104.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|