C16H14N8S — CID 19571325
4-[1-[(3,5-dimethylpyrazol-1-yl)methyl]pyrazol-3-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19571325) has the molecular formula C16H14N8S and a molecular weight of 350.41 g/mol. Its IUPAC name is 4-[1-[(3,5-dimethylpyrazol-1-yl)methyl]pyrazol-3-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[1-[(3,5-dimethylpyrazol-1-yl)methyl]pyrazol-3-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19571325 |
| Molecular Formula | C16H14N8S |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-[1-[(3,5-dimethylpyrazol-1-yl)methyl]pyrazol-3-yl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1cc(C)n(Cn2ccc(-c3nc4c5ccsc5ncn4n3)n2)n1 |
| InChI | InChI=1S/C16H14N8S/c1-10-7-11(2)24(19-10)9-22-5-3-13(20-22)14-18-15-12-4-6-25-16(12)17-8-23(15)21-14/h3-8H,9H2,1-2H3 |
| InChIKey | CPLUEZXYEAXOHJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |