C13H8F4N6S — CID 19573702
4-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19573702) has the molecular formula C13H8F4N6S and a molecular weight of 356.31 g/mol. Its IUPAC name is 4-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19573702 |
| Molecular Formula | C13H8F4N6S |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 4-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | FC(F)c1cc(C(F)F)n(Cc2nc3c4ccsc4ncn3n2)n1 |
| InChI | InChI=1S/C13H8F4N6S/c14-10(15)7-3-8(11(16)17)22(20-7)4-9-19-12-6-1-2-24-13(6)18-5-23(12)21-9/h1-3,5,10-11H,4H2 |
| InChIKey | NJIRPMHCYDRZKW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |