C12H8N4OS — CID 19571317
4-(2-methylfuran-3-yl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19571317) has the molecular formula C12H8N4OS and a molecular weight of 256.29 g/mol. Its IUPAC name is 4-(2-methylfuran-3-yl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-(2-methylfuran-3-yl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19571317 |
| Molecular Formula | C12H8N4OS |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 4-(2-methylfuran-3-yl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1occc1-c1nc2c3ccsc3ncn2n1 |
| InChI | InChI=1S/C12H8N4OS/c1-7-8(2-4-17-7)10-14-11-9-3-5-18-12(9)13-6-16(11)15-10/h2-6H,1H3 |
| InChIKey | BFJJQQYTOPVWAZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |