C20H12F2N4OS — CID 19571321
4-[2-[(2,4-difluorophenoxy)methyl]phenyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19571321) has the molecular formula C20H12F2N4OS and a molecular weight of 394.41 g/mol. Its IUPAC name is 4-[2-[(2,4-difluorophenoxy)methyl]phenyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[2-[(2,4-difluorophenoxy)methyl]phenyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19571321 |
| Molecular Formula | C20H12F2N4OS |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 4-[2-[(2,4-difluorophenoxy)methyl]phenyl]-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Fc1ccc(OCc2ccccc2-c2nc3c4ccsc4ncn3n2)c(F)c1 |
| InChI | InChI=1S/C20H12F2N4OS/c21-13-5-6-17(16(22)9-13)27-10-12-3-1-2-4-14(12)18-24-19-15-7-8-28-20(15)23-11-26(19)25-18/h1-9,11H,10H2 |
| InChIKey | CIEZVYXTLMCVKG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |