C13H9ClN6 — CID 101486254
4-(4-chlorophenyl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene (PubChem CID 101486254) has the molecular formula C13H9ClN6 and a molecular weight of 284.71 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene.
| Compound Name | 4-(4-chlorophenyl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene |
|---|---|
| PubChem CID | 101486254 |
| Molecular Formula | C13H9ClN6 |
| Molecular Weight | 284.71 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 4-(4-chlorophenyl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene |
| SMILES | Cn1cc2c(ncn3nc(-c4ccc(Cl)cc4)nc23)n1 |
| InChI | InChI=1S/C13H9ClN6/c1-19-6-10-12(17-19)15-7-20-13(10)16-11(18-20)8-2-4-9(14)5-3-8/h2-7H,1H3 |
| InChIKey | WCUDYYFLOUBDHF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.71 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |