C13H10N6 — CID 101486247
11-methyl-4-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene (PubChem CID 101486247) has the molecular formula C13H10N6 and a molecular weight of 250.27 g/mol. Its IUPAC name is 11-methyl-4-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene.
| Compound Name | 11-methyl-4-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene |
|---|---|
| PubChem CID | 101486247 |
| Molecular Formula | C13H10N6 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 11-methyl-4-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene |
| SMILES | Cn1cc2c(ncn3nc(-c4ccccc4)nc23)n1 |
| InChI | InChI=1S/C13H10N6/c1-18-7-10-12(16-18)14-8-19-13(10)15-11(17-19)9-5-3-2-4-6-9/h2-8H,1H3 |
| InChIKey | NZMLLIDZCNGVAA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |