C19H17N5OS — CID 19573372
4-[1-(12-ethyl-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)ethoxy]benzonitrile (PubChem CID 19573372) has the molecular formula C19H17N5OS and a molecular weight of 363.45 g/mol. Its IUPAC name is 4-[1-(12-ethyl-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)ethoxy]benzonitrile.
| Compound Name | 4-[1-(12-ethyl-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 19573372 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 4-[1-(12-ethyl-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)ethoxy]benzonitrile |
| SMILES | CCc1c(C)sc2ncn3nc(C(C)Oc4ccc(C#N)cc4)nc3c12 |
| InChI | InChI=1S/C19H17N5OS/c1-4-15-12(3)26-19-16(15)18-22-17(23-24(18)10-21-19)11(2)25-14-7-5-13(9-20)6-8-14/h5-8,10-11H,4H2,1-3H3 |
| InChIKey | CQYOGDWVJIJQGF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |