C11H14N4O3 — CID 19577196
1-methyl-4-nitro-N,N-bis(prop-2-enyl)pyrazole-5-carboxamide (PubChem CID 19577196) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 1-methyl-4-nitro-N,N-bis(prop-2-enyl)pyrazole-5-carboxamide.
| Compound Name | 1-methyl-4-nitro-N,N-bis(prop-2-enyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19577196 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-methyl-4-nitro-N,N-bis(prop-2-enyl)pyrazole-5-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1c([N+](=O)[O-])cnn1C |
| InChI | InChI=1S/C11H14N4O3/c1-4-6-14(7-5-2)11(16)10-9(15(17)18)8-12-13(10)3/h4-5,8H,1-2,6-7H2,3H3 |
| InChIKey | MBJCTKZSMKLKQQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|