C11H16F3N5O3 — CID 75396020
1-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-nitropyrazole-5-carboxamide (PubChem CID 75396020) has the molecular formula C11H16F3N5O3 and a molecular weight of 323.28 g/mol. Its IUPAC name is 1-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-nitropyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 75396020 |
| Molecular Formula | C11H16F3N5O3 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-nitropyrazole-5-carboxamide |
| SMILES | CN(CCCNC(=O)c1c([N+](=O)[O-])cnn1C)CC(F)(F)F |
| InChI | InChI=1S/C11H16F3N5O3/c1-17(7-11(12,13)14)5-3-4-15-10(20)9-8(19(21)22)6-16-18(9)2/h6H,3-5,7H2,1-2H3,(H,15,20) |
| InChIKey | AXFKUQDBAKDLEL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|