C15H18F3N5O — CID 55720473
N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-6-pyrazol-1-ylpyridine-3-carboxamide (PubChem CID 55720473) has the molecular formula C15H18F3N5O and a molecular weight of 341.34 g/mol. Its IUPAC name is N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-6-pyrazol-1-ylpyridine-3-carboxamide.
| Compound Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-6-pyrazol-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 55720473 |
| Molecular Formula | C15H18F3N5O |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-6-pyrazol-1-ylpyridine-3-carboxamide |
| SMILES | CN(CCCNC(=O)c1ccc(-n2cccn2)nc1)CC(F)(F)F |
| InChI | InChI=1S/C15H18F3N5O/c1-22(11-15(16,17)18)8-2-6-19-14(24)12-4-5-13(20-10-12)23-9-3-7-21-23/h3-5,7,9-10H,2,6,8,11H2,1H3,(H,19,24) |
| InChIKey | RUPUMVREUNRICK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|