C38H32N2O8P2S2-2 — CID 19578938
3-diphenylphosphoryl-4-[2-(2-diphenylphosphoryl-4-sulfonatoanilino)ethylamino]benzenesulfonate (PubChem CID 19578938) has the molecular formula C38H32N2O8P2S2-2 and a molecular weight of 770.76 g/mol. Its IUPAC name is 3-diphenylphosphoryl-4-[2-(2-diphenylphosphoryl-4-sulfonatoanilino)ethylamino]benzenesulfonate.
| Compound Name | 3-diphenylphosphoryl-4-[2-(2-diphenylphosphoryl-4-sulfonatoanilino)ethylamino]benzenesulfonate |
|---|---|
| PubChem CID | 19578938 |
| Molecular Formula | C38H32N2O8P2S2-2 |
| Molecular Weight | 770.76 g/mol |
| Exact Mass | 770.11 |
| IUPAC Name | 3-diphenylphosphoryl-4-[2-(2-diphenylphosphoryl-4-sulfonatoanilino)ethylamino]benzenesulfonate |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1cc(S(=O)(=O)[O-])ccc1NCCNc1ccc(S(=O)(=O)[O-])cc1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H34N2O8P2S2/c41-49(29-13-5-1-6-14-29,30-15-7-2-8-16-30)37-27-33(51(43,44)45)21-23-35(37)39-25-26-40-36-24-22-34(52(46,47)48)28-38(36)50(42,31-17-9-3-10-18-31)32-19-11-4-12-20-32/h1-24,27-28,39-40H,25-26H2,(H,43,44,45)(H,46,47,48)/p-2 |
| InChIKey | WFHACSVWZATLBX-UHFFFAOYSA-L |
| XLogP | 4.30 |
| TPSA | 172.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.76 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|