C19H17NNaO4PS — CID 23670325
sodium 3-diphenylphosphoryl-4-(methylamino)benzenesulfonate (PubChem CID 23670325) has the molecular formula C19H17NNaO4PS and a molecular weight of 409.38 g/mol. Its IUPAC name is sodium 3-diphenylphosphoryl-4-(methylamino)benzenesulfonate.
| Compound Name | sodium 3-diphenylphosphoryl-4-(methylamino)benzenesulfonate |
|---|---|
| PubChem CID | 23670325 |
| Molecular Formula | C19H17NNaO4PS |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | sodium 3-diphenylphosphoryl-4-(methylamino)benzenesulfonate |
| SMILES | CNc1ccc(S(=O)(=O)[O-])cc1P(=O)(c1ccccc1)c1ccccc1.[Na+] |
| InChI | InChI=1S/C19H18NO4PS.Na/c1-20-18-13-12-17(26(22,23)24)14-19(18)25(21,15-8-4-2-5-9-15)16-10-6-3-7-11-16;/h2-14,20H,1H3,(H,22,23,24);/q;+1/p-1 |
| InChIKey | AILGOINIRDFXMU-UHFFFAOYSA-M |
| XLogP | -0.72 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|