C18H24N4O3S — CID 19579633
(E)-3-(1-ethyl-3,5-dimethylpyrazol-4-yl)-N-[4-(ethylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 19579633) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is (E)-3-(1-ethyl-3,5-dimethylpyrazol-4-yl)-N-[4-(ethylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(1-ethyl-3,5-dimethylpyrazol-4-yl)-N-[4-(ethylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 19579633 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (E)-3-(1-ethyl-3,5-dimethylpyrazol-4-yl)-N-[4-(ethylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CCNS(=O)(=O)c1ccc(NC(=O)/C=C/c2c(C)nn(CC)c2C)cc1 |
| InChI | InChI=1S/C18H24N4O3S/c1-5-19-26(24,25)16-9-7-15(8-10-16)20-18(23)12-11-17-13(3)21-22(6-2)14(17)4/h7-12,19H,5-6H2,1-4H3,(H,20,23)/b12-11+ |
| InChIKey | LHZOTHHMQQAZAF-VAWYXSNFSA-N |
| XLogP | 2.47 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|