C30H26F3N3O5S — CID 19581685
2-[2-methoxy-4-[(E)-[3-(4-methoxyphenyl)-5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 19581685) has the molecular formula C30H26F3N3O5S and a molecular weight of 597.62 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-[3-(4-methoxyphenyl)-5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-methoxy-4-[(E)-[3-(4-methoxyphenyl)-5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 19581685 |
| Molecular Formula | C30H26F3N3O5S |
| Molecular Weight | 597.62 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-[3-(4-methoxyphenyl)-5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | C=CCN1C(=O)/C(=C\c2ccc(OCC(=O)Nc3cccc(C(F)(F)F)c3)c(OC)c2)N(c2ccc(OC)cc2)C1=S |
| InChI | InChI=1S/C30H26F3N3O5S/c1-4-14-35-28(38)24(36(29(35)42)22-9-11-23(39-2)12-10-22)15-19-8-13-25(26(16-19)40-3)41-18-27(37)34-21-7-5-6-20(17-21)30(31,32)33/h4-13,15-17H,1,14,18H2,2-3H3,(H,34,37)/b24-15+ |
| InChIKey | SJLUTHNSITZFGW-BUVRLJJBSA-N |
| XLogP | 5.90 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|