C20H13N5O4 — CID 19583180
2-[5-[(4-nitrophenoxy)methyl]furan-2-yl]-[1,2,4]triazolo[1,5-c]quinazoline (PubChem CID 19583180) has the molecular formula C20H13N5O4 and a molecular weight of 387.36 g/mol. Its IUPAC name is 2-[5-[(4-nitrophenoxy)methyl]furan-2-yl]-[1,2,4]triazolo[1,5-c]quinazoline.
| Compound Name | 2-[5-[(4-nitrophenoxy)methyl]furan-2-yl]-[1,2,4]triazolo[1,5-c]quinazoline |
|---|---|
| PubChem CID | 19583180 |
| Molecular Formula | C20H13N5O4 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-[5-[(4-nitrophenoxy)methyl]furan-2-yl]-[1,2,4]triazolo[1,5-c]quinazoline |
| SMILES | O=[N+]([O-])c1ccc(OCc2ccc(-c3nc4c5ccccc5ncn4n3)o2)cc1 |
| InChI | InChI=1S/C20H13N5O4/c26-25(27)13-5-7-14(8-6-13)28-11-15-9-10-18(29-15)19-22-20-16-3-1-2-4-17(16)21-12-24(20)23-19/h1-10,12H,11H2 |
| InChIKey | PZFNNISSSFJSRQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 108.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|