C21H20Cl2N8OS — CID 19588360
1-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-[(1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbonyl)amino]thiourea (PubChem CID 19588360) has the molecular formula C21H20Cl2N8OS and a molecular weight of 503.42 g/mol. Its IUPAC name is 1-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-[(1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbonyl)amino]thiourea.
| Compound Name | 1-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-[(1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 19588360 |
| Molecular Formula | C21H20Cl2N8OS |
| Molecular Weight | 503.42 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 1-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-[(1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbonyl)amino]thiourea |
| SMILES | Cc1cc(C(=O)NNC(=S)Nc2cnn(Cc3ccc(Cl)c(Cl)c3)c2)c2c(C)nn(C)c2n1 |
| InChI | InChI=1S/C21H20Cl2N8OS/c1-11-6-15(18-12(2)29-30(3)19(18)25-11)20(32)27-28-21(33)26-14-8-24-31(10-14)9-13-4-5-16(22)17(23)7-13/h4-8,10H,9H2,1-3H3,(H,27,32)(H2,26,28,33) |
| InChIKey | XJEXJSFOYIIOEF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 101.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|