C24H26N8OS — CID 19588616
1-[(6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]-3-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19588616) has the molecular formula C24H26N8OS and a molecular weight of 474.59 g/mol. Its IUPAC name is 1-[(6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]-3-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[(6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]-3-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19588616 |
| Molecular Formula | C24H26N8OS |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 1-[(6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]-3-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Cc1ccc(Cn2cc(NC(=S)NNC(=O)c3cc(C4CC4)nc4c3c(C)nn4C)cn2)cc1 |
| InChI | InChI=1S/C24H26N8OS/c1-14-4-6-16(7-5-14)12-32-13-18(11-25-32)26-24(34)29-28-23(33)19-10-20(17-8-9-17)27-22-21(19)15(2)30-31(22)3/h4-7,10-11,13,17H,8-9,12H2,1-3H3,(H,28,33)(H2,26,29,34) |
| InChIKey | LCOZQITWAFUPKE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 101.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|