C23H22Cl2N8OS — CID 19588520
1-[(6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]-3-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19588520) has the molecular formula C23H22Cl2N8OS and a molecular weight of 529.46 g/mol. Its IUPAC name is 1-[(6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]-3-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[(6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]-3-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19588520 |
| Molecular Formula | C23H22Cl2N8OS |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | 1-[(6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]-3-[1-[(3,4-dichlorophenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Cc1nn(C)c2nc(C3CC3)cc(C(=O)NNC(=S)Nc3cnn(Cc4ccc(Cl)c(Cl)c4)c3)c12 |
| InChI | InChI=1S/C23H22Cl2N8OS/c1-12-20-16(8-19(14-4-5-14)28-21(20)32(2)31-12)22(34)29-30-23(35)27-15-9-26-33(11-15)10-13-3-6-17(24)18(25)7-13/h3,6-9,11,14H,4-5,10H2,1-2H3,(H,29,34)(H2,27,30,35) |
| InChIKey | HCXRSUNJCGYJRS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 101.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|