C23H22ClFN8OS — CID 19588560
1-[4-chloro-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-3-[(6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]thiourea (PubChem CID 19588560) has the molecular formula C23H22ClFN8OS and a molecular weight of 513.00 g/mol. Its IUPAC name is 1-[4-chloro-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-3-[(6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]thiourea.
| Compound Name | 1-[4-chloro-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-3-[(6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 19588560 |
| Molecular Formula | C23H22ClFN8OS |
| Molecular Weight | 513.00 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 1-[4-chloro-1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-3-[(6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]thiourea |
| SMILES | Cc1nn(C)c2nc(C3CC3)cc(C(=O)NNC(=S)Nc3nn(Cc4ccc(F)cc4)cc3Cl)c12 |
| InChI | InChI=1S/C23H22ClFN8OS/c1-12-19-16(9-18(14-5-6-14)26-21(19)32(2)30-12)22(34)28-29-23(35)27-20-17(24)11-33(31-20)10-13-3-7-15(25)8-4-13/h3-4,7-9,11,14H,5-6,10H2,1-2H3,(H,28,34)(H2,27,29,31,35) |
| InChIKey | OBSVVZYXGMQYEM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.00 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|