C17H16NO2- — CID 19591955
2-(13-amino-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)acetate (PubChem CID 19591955) has the molecular formula C17H16NO2- and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-(13-amino-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)acetate.
| Compound Name | 2-(13-amino-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)acetate |
|---|---|
| PubChem CID | 19591955 |
| Molecular Formula | C17H16NO2- |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-(13-amino-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)acetate |
| SMILES | Nc1ccc2c(c1)CC(CC(=O)[O-])c1ccccc1C2 |
| InChI | InChI=1S/C17H17NO2/c18-15-6-5-11-7-12-3-1-2-4-16(12)14(10-17(19)20)8-13(11)9-15/h1-6,9,14H,7-8,10,18H2,(H,19,20)/p-1 |
| InChIKey | COSUFTNQZPVQOX-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|