C23H26F2NNaO2 — CID 143368926
sodium;(10R)-6-fluoro-10-(2-fluoroethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene;1-methylpyrrolidine-3-carboxylate (PubChem CID 143368926) has the molecular formula C23H26F2NNaO2 and a molecular weight of 409.45 g/mol. Its IUPAC name is sodium;(10R)-6-fluoro-10-(2-fluoroethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene;1-methylpyrrolidine-3-carboxylate.
| Compound Name | sodium;(10R)-6-fluoro-10-(2-fluoroethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene;1-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 143368926 |
| Molecular Formula | C23H26F2NNaO2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | sodium;(10R)-6-fluoro-10-(2-fluoroethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene;1-methylpyrrolidine-3-carboxylate |
| SMILES | CN1CCC(C(=O)[O-])C1.FCC[C@H]1Cc2cc(F)ccc2Cc2ccccc21.[Na+] |
| InChI | InChI=1S/C17H16F2.C6H11NO2.Na/c18-8-7-14-10-15-11-16(19)6-5-12(15)9-13-3-1-2-4-17(13)14;1-7-3-2-5(4-7)6(8)9;/h1-6,11,14H,7-10H2;5H,2-4H2,1H3,(H,8,9);/q;;+1/p-1/t14-;;/m0../s1 |
| InChIKey | IKRQFFSVWQOMQS-UTLKBRERSA-M |
| XLogP | 0.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |