C24H25ClFNO2 — CID 59827039
1-[[(2R,4S,6R)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl]piperidine-4-carbonyl chloride (PubChem CID 59827039) has the molecular formula C24H25ClFNO2 and a molecular weight of 413.92 g/mol. Its IUPAC name is 1-[[(2R,4S,6R)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl]piperidine-4-carbonyl chloride.
| Compound Name | 1-[[(2R,4S,6R)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl]piperidine-4-carbonyl chloride |
|---|---|
| PubChem CID | 59827039 |
| Molecular Formula | C24H25ClFNO2 |
| Molecular Weight | 413.92 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 1-[[(2R,4S,6R)-17-fluoro-3-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7,9,11,15,17-hexaen-4-yl]methyl]piperidine-4-carbonyl chloride |
| SMILES | O=C(Cl)C1CCN(C[C@@H]2C[C@@H]3c4ccccc4Cc4ccc(F)cc4[C@@H]3O2)CC1 |
| InChI | InChI=1S/C24H25ClFNO2/c25-24(28)15-7-9-27(10-8-15)14-19-13-22-20-4-2-1-3-16(20)11-17-5-6-18(26)12-21(17)23(22)29-19/h1-6,12,15,19,22-23H,7-11,13-14H2/t19-,22+,23-/m0/s1 |
| InChIKey | TXSKNCWRUGBNQD-PMOQBDJRSA-N |
| XLogP | 4.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.92 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|