C23H33FNOS2+ — CID 143335812
[1-(dimethylamino)-3-(13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)propan-2-yl]-methoxy-methylsulfanium;methanethiol (PubChem CID 143335812) has the molecular formula C23H33FNOS2+ and a molecular weight of 422.66 g/mol. Its IUPAC name is [1-(dimethylamino)-3-(13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)propan-2-yl]-methoxy-methylsulfanium;methanethiol.
| Compound Name | [1-(dimethylamino)-3-(13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)propan-2-yl]-methoxy-methylsulfanium;methanethiol |
|---|---|
| PubChem CID | 143335812 |
| Molecular Formula | C23H33FNOS2+ |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | [1-(dimethylamino)-3-(13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)propan-2-yl]-methoxy-methylsulfanium;methanethiol |
| SMILES | CO[S+](C)C(CC1Cc2cc(F)ccc2Cc2ccccc21)CN(C)C.CS |
| InChI | InChI=1S/C22H29FNOS.CH4S/c1-24(2)15-21(26(4)25-3)14-19-12-18-13-20(23)10-9-16(18)11-17-7-5-6-8-22(17)19;1-2/h5-10,13,19,21H,11-12,14-15H2,1-4H3;2H,1H3/q+1; |
| InChIKey | YZVPVILMZUDUPK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|