C20H23FO — CID 23597668
1-(13-fluoro-10-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)butan-2-ol (PubChem CID 23597668) has the molecular formula C20H23FO and a molecular weight of 298.40 g/mol. Its IUPAC name is 1-(13-fluoro-10-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)butan-2-ol.
| Compound Name | 1-(13-fluoro-10-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)butan-2-ol |
|---|---|
| PubChem CID | 23597668 |
| Molecular Formula | C20H23FO |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-(13-fluoro-10-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl)butan-2-ol |
| SMILES | CCC(O)CC1c2ccccc2Cc2ccc(F)cc2C1C |
| InChI | InChI=1S/C20H23FO/c1-3-17(22)12-20-13(2)19-11-16(21)9-8-15(19)10-14-6-4-5-7-18(14)20/h4-9,11,13,17,20,22H,3,10,12H2,1-2H3 |
| InChIKey | DHCUYLZYAGKLGH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |