C19H19FN6O3S — CID 140531744
[(2R)-1-azido-3-[(9R,10R)-10-azido-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]propan-2-yl] methanesulfonate (PubChem CID 140531744) has the molecular formula C19H19FN6O3S and a molecular weight of 430.47 g/mol. Its IUPAC name is [(2R)-1-azido-3-[(9R,10R)-10-azido-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]propan-2-yl] methanesulfonate.
| Compound Name | [(2R)-1-azido-3-[(9R,10R)-10-azido-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]propan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 140531744 |
| Molecular Formula | C19H19FN6O3S |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | [(2R)-1-azido-3-[(9R,10R)-10-azido-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]propan-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H](CN=[N+]=[N-])C[C@@H]1c2ccccc2Cc2ccc(F)cc2[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C19H19FN6O3S/c1-30(27,28)29-15(11-23-25-21)10-18-16-5-3-2-4-12(16)8-13-6-7-14(20)9-17(13)19(18)24-26-22/h2-7,9,15,18-19H,8,10-11H2,1H3/t15-,18-,19+/m1/s1 |
| InChIKey | OKSFOJDDBCSTFW-LZQZEXGQSA-N |
| XLogP | 4.91 |
| TPSA | 140.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|