C19H20FN3O — CID 160679533
(2S)-1-[(9R,10R)-10-azido-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]butan-2-ol (PubChem CID 160679533) has the molecular formula C19H20FN3O and a molecular weight of 325.39 g/mol. Its IUPAC name is (2S)-1-[(9R,10R)-10-azido-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]butan-2-ol.
| Compound Name | (2S)-1-[(9R,10R)-10-azido-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]butan-2-ol |
|---|---|
| PubChem CID | 160679533 |
| Molecular Formula | C19H20FN3O |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (2S)-1-[(9R,10R)-10-azido-13-fluoro-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]butan-2-ol |
| SMILES | CC[C@H](O)C[C@@H]1c2ccccc2Cc2ccc(F)cc2[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C19H20FN3O/c1-2-15(24)11-18-16-6-4-3-5-12(16)9-13-7-8-14(20)10-17(13)19(18)22-23-21/h3-8,10,15,18-19,24H,2,9,11H2,1H3/t15-,18+,19-/m0/s1 |
| InChIKey | RNYMGYDMLOYVSB-IPELMVKDSA-N |
| XLogP | 5.03 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|